C15H15ClN4 — CID 168544054
2-[(3-chloro-4-piperidin-1-ylanilino)methylidene]propanedinitrile (PubChem CID 168544054) has the molecular formula C15H15ClN4 and a molecular weight of 286.77 g/mol. Its IUPAC name is 2-[(3-chloro-4-piperidin-1-ylanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(3-chloro-4-piperidin-1-ylanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544054 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[(3-chloro-4-piperidin-1-ylanilino)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(N2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H15ClN4/c16-14-8-13(19-11-12(9-17)10-18)4-5-15(14)20-6-2-1-3-7-20/h4-5,8,11,19H,1-3,6-7H2 |
| InChIKey | LVJGGJRJOPUNLC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|