C12H7ClN6 — CID 168542544
2-[[3-chloro-4-(1,2,4-triazol-1-yl)anilino]methylidene]propanedinitrile (PubChem CID 168542544) has the molecular formula C12H7ClN6 and a molecular weight of 270.68 g/mol. Its IUPAC name is 2-[[3-chloro-4-(1,2,4-triazol-1-yl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-chloro-4-(1,2,4-triazol-1-yl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542544 |
| Molecular Formula | C12H7ClN6 |
| Molecular Weight | 270.68 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-[[3-chloro-4-(1,2,4-triazol-1-yl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(-n2cncn2)c(Cl)c1 |
| InChI | InChI=1S/C12H7ClN6/c13-11-3-10(17-6-9(4-14)5-15)1-2-12(11)19-8-16-7-18-19/h1-3,6-8,17H |
| InChIKey | QLAFSSIHORCADN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|