C13H10N6O — CID 168544765
2-[[3-methoxy-5-(1,2,4-triazol-1-yl)anilino]methylidene]propanedinitrile (PubChem CID 168544765) has the molecular formula C13H10N6O and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-[[3-methoxy-5-(1,2,4-triazol-1-yl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-methoxy-5-(1,2,4-triazol-1-yl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544765 |
| Molecular Formula | C13H10N6O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[[3-methoxy-5-(1,2,4-triazol-1-yl)anilino]methylidene]propanedinitrile |
| SMILES | COc1cc(NC=C(C#N)C#N)cc(-n2cncn2)c1 |
| InChI | InChI=1S/C13H10N6O/c1-20-13-3-11(17-7-10(5-14)6-15)2-12(4-13)19-9-16-8-18-19/h2-4,7-9,17H,1H3 |
| InChIKey | HURDPWSBRZAAGM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|