C17H13ClN4O3 — CID 53367715
2-[2-[3-chloro-4-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl]benzoic acid (PubChem CID 53367715) has the molecular formula C17H13ClN4O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is 2-[2-[3-chloro-4-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-[3-chloro-4-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 53367715 |
| Molecular Formula | C17H13ClN4O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[2-[3-chloro-4-(1,2,4-triazol-1-yl)anilino]-2-oxoethyl]benzoic acid |
| SMILES | O=C(Cc1ccccc1C(=O)O)Nc1ccc(-n2cncn2)c(Cl)c1 |
| InChI | InChI=1S/C17H13ClN4O3/c18-14-8-12(5-6-15(14)22-10-19-9-20-22)21-16(23)7-11-3-1-2-4-13(11)17(24)25/h1-6,8-10H,7H2,(H,21,23)(H,24,25) |
| InChIKey | XOLGTJJVEKDXLC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |