C16H15NO3 — CID 12558883
2-[2-(4-methylanilino)-2-oxoethyl]benzoic acid (PubChem CID 12558883) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[2-(4-methylanilino)-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-(4-methylanilino)-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 12558883 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[2-(4-methylanilino)-2-oxoethyl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)Cc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C16H15NO3/c1-11-6-8-13(9-7-11)17-15(18)10-12-4-2-3-5-14(12)16(19)20/h2-9H,10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | HDYWJHHUWWPAAX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |