C18H15N3O5 — CID 135634456
2-[2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)anilino]-2-oxoethyl]benzoic acid (PubChem CID 135634456) has the molecular formula C18H15N3O5 and a molecular weight of 353.33 g/mol. Its IUPAC name is 2-[2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)anilino]-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)anilino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 135634456 |
| Molecular Formula | C18H15N3O5 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)anilino]-2-oxoethyl]benzoic acid |
| SMILES | Cc1nnc(-c2cc(NC(=O)Cc3ccccc3C(=O)O)ccc2O)o1 |
| InChI | InChI=1S/C18H15N3O5/c1-10-20-21-17(26-10)14-9-12(6-7-15(14)22)19-16(23)8-11-4-2-3-5-13(11)18(24)25/h2-7,9,22H,8H2,1H3,(H,19,23)(H,24,25) |
| InChIKey | NHIVCZDVLDJGLW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|