C10H10N4O2S — CID 169357970
[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thiourea (PubChem CID 169357970) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is [4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thiourea.
| Compound Name | [4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 169357970 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | [4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thiourea |
| SMILES | Cc1nnc(-c2cc(NC(N)=S)ccc2O)o1 |
| InChI | InChI=1S/C10H10N4O2S/c1-5-13-14-9(16-5)7-4-6(12-10(11)17)2-3-8(7)15/h2-4,15H,1H3,(H3,11,12,17) |
| InChIKey | IIHNJTLSJFNTTJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|