C17H11N3O4 — CID 168517903
2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]isoindole-1,3-dione (PubChem CID 168517903) has the molecular formula C17H11N3O4 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517903 |
| Molecular Formula | C17H11N3O4 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1nnc(-c2cc(N3C(=O)c4ccccc4C3=O)ccc2O)o1 |
| InChI | InChI=1S/C17H11N3O4/c1-9-18-19-15(24-9)13-8-10(6-7-14(13)21)20-16(22)11-4-2-3-5-12(11)17(20)23/h2-8,21H,1H3 |
| InChIKey | XOCOAIDKMSFGFK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|