About 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole
2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole (PubChem CID 131089626) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole.
Analyze 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole?
The IUPAC name of 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole (CID 131089626) is 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole?
The canonical SMILES for 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole is Cc1nnc(-c2cccnc2C)o1.
What is the InChIKey of 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole?
The InChIKey is VRUDYMFLUMCVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c1-6-8(4-3-5-10-6)9-12-11-7(2)13-9/h3-5H,1-2H3.
What are the key properties of 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole?
2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole has a molecular weight of 175.19 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(2-methyl-3-pyridinyl)-1,3,4-oxadiazole is sourced from PubChem (CID 131089626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).