C10H10ClN3O3S — CID 63666407
1-chloro-N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanesulfonamide (PubChem CID 63666407) has the molecular formula C10H10ClN3O3S and a molecular weight of 287.73 g/mol. Its IUPAC name is 1-chloro-N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 63666407 |
| Molecular Formula | C10H10ClN3O3S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 1-chloro-N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]methanesulfonamide |
| SMILES | Cc1nnc(-c2ccccc2NS(=O)(=O)CCl)o1 |
| InChI | InChI=1S/C10H10ClN3O3S/c1-7-12-13-10(17-7)8-4-2-3-5-9(8)14-18(15,16)6-11/h2-5,14H,6H2,1H3 |
| InChIKey | YPKKMXJFHAKVCJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|