C9H12ClNO2S — CID 63665725
1-chloro-N-(2,3-dimethylphenyl)methanesulfonamide (PubChem CID 63665725) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is 1-chloro-N-(2,3-dimethylphenyl)methanesulfonamide.
| Compound Name | 1-chloro-N-(2,3-dimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 63665725 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 1-chloro-N-(2,3-dimethylphenyl)methanesulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)CCl)c1C |
| InChI | InChI=1S/C9H12ClNO2S/c1-7-4-3-5-9(8(7)2)11-14(12,13)6-10/h3-5,11H,6H2,1-2H3 |
| InChIKey | FWYOVUFKSQTLDY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|