C10H11N3O2 — CID 102660795
1-[5-(2-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 102660795) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 1-[5-(2-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 1-[5-(2-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 102660795 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1-[5-(2-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | Cc1ncccc1-c1nc(C(C)O)no1 |
| InChI | InChI=1S/C10H11N3O2/c1-6-8(4-3-5-11-6)10-12-9(7(2)14)13-15-10/h3-5,7,14H,1-2H3 |
| InChIKey | UZBLVFROLYLLBC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |