C12H14N2O2 — CID 102660575
1-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 102660575) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 1-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 102660575 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | Cc1ccc(-c2nc(C(C)O)no2)c(C)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-7-4-5-10(8(2)6-7)12-13-11(9(3)15)14-16-12/h4-6,9,15H,1-3H3 |
| InChIKey | NZYVCCILYBDYAK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |