C10H9FN2O2 — CID 102660763
1-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 102660763) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 1-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 1-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 102660763 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 1-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | CC(O)c1noc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C10H9FN2O2/c1-6(14)9-12-10(15-13-9)7-4-2-3-5-8(7)11/h2-6,14H,1H3 |
| InChIKey | USJUTNUGRKRYOH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |