C10H11N3O2 — CID 137002843
2-[3-(1-aminoethyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 137002843) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-[3-(1-aminoethyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-[3-(1-aminoethyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 137002843 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-[3-(1-aminoethyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CC(N)c1noc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C10H11N3O2/c1-6(11)9-12-10(15-13-9)7-4-2-3-5-8(7)14/h2-6,14H,11H2,1H3 |
| InChIKey | HWMHHBOIUYJZFR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |