C10H8N2O3 — CID 137002833
1-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]ethanone (PubChem CID 137002833) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 1-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 137002833 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)c1noc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C10H8N2O3/c1-6(13)9-11-10(15-12-9)7-4-2-3-5-8(7)14/h2-5,14H,1H3 |
| InChIKey | KKQUPUQORBUUNW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |