C9H8N2O2Zn — CID 135979761
2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol;zinc (PubChem CID 135979761) has the molecular formula C9H8N2O2Zn and a molecular weight of 241.56 g/mol. Its IUPAC name is 2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol;zinc.
| Compound Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol;zinc |
|---|---|
| PubChem CID | 135979761 |
| Molecular Formula | C9H8N2O2Zn |
| Molecular Weight | 241.56 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol;zinc |
| SMILES | Cc1noc(-c2ccccc2O)n1.[Zn] |
| InChI | InChI=1S/C9H8N2O2.Zn/c1-6-10-9(13-11-6)7-4-2-3-5-8(7)12;/h2-5,12H,1H3; |
| InChIKey | LNGXJYSWVWTDGS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.56 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|