C10H11N3O — CID 68946909
[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanamine (PubChem CID 68946909) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is [2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanamine.
| Compound Name | [2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 68946909 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | [2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanamine |
| SMILES | Cc1noc(-c2ccccc2CN)n1 |
| InChI | InChI=1S/C10H11N3O/c1-7-12-10(14-13-7)9-5-3-2-4-8(9)6-11/h2-5H,6,11H2,1H3 |
| InChIKey | MOTYYUZNWIPCIH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |