C11H13N7O — CID 168601956
1-(diaminomethylidene)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]guanidine (PubChem CID 168601956) has the molecular formula C11H13N7O and a molecular weight of 259.27 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168601956 |
| Molecular Formula | C11H13N7O |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]guanidine |
| SMILES | Cc1noc(-c2ccccc2/N=C(\N)N=C(N)N)n1 |
| InChI | InChI=1S/C11H13N7O/c1-6-15-9(19-18-6)7-4-2-3-5-8(7)16-11(14)17-10(12)13/h2-5H,1H3,(H6,12,13,14,16,17) |
| InChIKey | LVXSWCIWMXCXJT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|