C12H11N5OS — CID 169360715
methyl N-cyano-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]carbamimidothioate (PubChem CID 169360715) has the molecular formula C12H11N5OS and a molecular weight of 273.32 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169360715 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | methyl N-cyano-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccccc1-c1nc(C)no1)NC#N |
| InChI | InChI=1S/C12H11N5OS/c1-8-15-11(18-17-8)9-5-3-4-6-10(9)16-12(19-2)14-7-13/h3-6H,1-2H3,(H,14,16) |
| InChIKey | XLBSRLXQNIAYSR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|