C11H11N5OS — CID 168536260
[[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methylideneamino]thiourea (PubChem CID 168536260) has the molecular formula C11H11N5OS and a molecular weight of 261.31 g/mol. Its IUPAC name is [[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methylideneamino]thiourea.
| Compound Name | [[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168536260 |
| Molecular Formula | C11H11N5OS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | [[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methylideneamino]thiourea |
| SMILES | Cc1noc(-c2ccccc2C=NNC(N)=S)n1 |
| InChI | InChI=1S/C11H11N5OS/c1-7-14-10(17-16-7)9-5-3-2-4-8(9)6-13-15-11(12)18/h2-6H,1H3,(H3,12,15,18) |
| InChIKey | IJPYYJAUFJBKKD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|