C8H10N4S — CID 5042042
[(6-methyl-2-pyridinyl)methylideneamino]thiourea (PubChem CID 5042042) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is [(6-methyl-2-pyridinyl)methylideneamino]thiourea.
| Compound Name | [(6-methyl-2-pyridinyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 5042042 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | [(6-methyl-2-pyridinyl)methylideneamino]thiourea |
| SMILES | Cc1cccc(C=NNC(N)=S)n1 |
| InChI | InChI=1S/C8H10N4S/c1-6-3-2-4-7(11-6)5-10-12-8(9)13/h2-5H,1H3,(H3,9,12,13) |
| InChIKey | RGSKQRUEJICXLG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|