C18H20N6O2 — CID 6371795
N,N'-bis[(Z)-(6-methyl-2-pyridinyl)methylideneamino]butanediamide (PubChem CID 6371795) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is N,N'-bis[(Z)-(6-methyl-2-pyridinyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(Z)-(6-methyl-2-pyridinyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 6371795 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N,N'-bis[(Z)-(6-methyl-2-pyridinyl)methylideneamino]butanediamide |
| SMILES | Cc1cccc(/C=N\NC(=O)CCC(=O)N/N=C\c2cccc(C)n2)n1 |
| InChI | InChI=1S/C18H20N6O2/c1-13-5-3-7-15(21-13)11-19-23-17(25)9-10-18(26)24-20-12-16-8-4-6-14(2)22-16/h3-8,11-12H,9-10H2,1-2H3,(H,23,25)(H,24,26)/b19-11-,20-12- |
| InChIKey | BXJKETIUGUWQKW-YZLQMOBTSA-N |
| XLogP | 1.47 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|