About bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc
bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc (PubChem CID 50918126) has the molecular formula C18H22N6S4Zn
and a molecular weight of 516.07 g/mol. Its IUPAC name is bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc.
Molecular Properties
| Compound Name | bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc |
| PubChem CID | 50918126 |
| Molecular Formula | C18H22N6S4Zn |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc |
| SMILES | CSC(=S)NN=Cc1cccc(C)n1.CSC(=S)NN=Cc1cccc(C)n1.[Zn] |
| InChI | InChI=1S/2C9H11N3S2.Zn/c2*1-7-4-3-5-8(11-7)6-10-12-9(13)14-2;/h2*3-6H,1-2H3,(H,12,13); |
| InChIKey | QFEDBBZCRCDTMY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc?
The IUPAC name of bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc (CID 50918126) is bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc.
What is the SMILES notation for bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc?
The canonical SMILES for bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc is CSC(=S)NN=Cc1cccc(C)n1.CSC(=S)NN=Cc1cccc(C)n1.[Zn].
What is the InChIKey of bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc?
The InChIKey is QFEDBBZCRCDTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11N3S2.Zn/c2*1-7-4-3-5-8(11-7)6-10-12-9(13)14-2;/h2*3-6H,1-2H3,(H,12,13);.
What are the key properties of bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc?
bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc has a molecular weight of 516.07 g/mol, XLogP of 3.92, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate);zinc is sourced from PubChem (CID 50918126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).