About bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel
bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel (PubChem CID 50911309) has the molecular formula C16H18N6NiS4
and a molecular weight of 481.32 g/mol. Its IUPAC name is bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel.
Molecular Properties
| Compound Name | bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel |
| PubChem CID | 50911309 |
| Molecular Formula | C16H18N6NiS4 |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel |
| SMILES | CSC(=S)NN=Cc1ccccn1.CSC(=S)NN=Cc1ccccn1.[Ni] |
| InChI | InChI=1S/2C8H9N3S2.Ni/c2*1-13-8(12)11-10-6-7-4-2-3-5-9-7;/h2*2-6H,1H3,(H,11,12); |
| InChIKey | RNDKHBUGUMSNRW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel?
The IUPAC name of bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel (CID 50911309) is bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel.
What is the SMILES notation for bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel?
The canonical SMILES for bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel is CSC(=S)NN=Cc1ccccn1.CSC(=S)NN=Cc1ccccn1.[Ni].
What is the InChIKey of bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel?
The InChIKey is RNDKHBUGUMSNRW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H9N3S2.Ni/c2*1-13-8(12)11-10-6-7-4-2-3-5-9-7;/h2*2-6H,1H3,(H,11,12);.
What are the key properties of bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel?
bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel has a molecular weight of 481.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(methyl N-(pyridin-2-ylmethylideneamino)carbamodithioate);nickel is sourced from PubChem (CID 50911309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).