C7H9FeN4O4S2- — CID 50909656
hydrogen sulfate;iron;(pyridin-2-ylmethylideneamino)thiourea (PubChem CID 50909656) has the molecular formula C7H9FeN4O4S2- and a molecular weight of 333.15 g/mol. Its IUPAC name is hydrogen sulfate;iron;(pyridin-2-ylmethylideneamino)thiourea.
| Compound Name | hydrogen sulfate;iron;(pyridin-2-ylmethylideneamino)thiourea |
|---|---|
| PubChem CID | 50909656 |
| Molecular Formula | C7H9FeN4O4S2- |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | hydrogen sulfate;iron;(pyridin-2-ylmethylideneamino)thiourea |
| SMILES | NC(=S)NN=Cc1ccccn1.O=S(=O)([O-])O.[Fe] |
| InChI | InChI=1S/C7H8N4S.Fe.H2O4S/c8-7(12)11-10-5-6-3-1-2-4-9-6;;1-5(2,3)4/h1-5H,(H3,8,11,12);;(H2,1,2,3,4)/p-1 |
| InChIKey | PHJYPYDGJDSCNS-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|