About CID 50936105
CID 50936105 (PubChem CID 50936105) has the molecular formula C14H16Cl2GaN8S2
and a molecular weight of 501.10 g/mol.
Molecular Properties
| Compound Name | CID 50936105 |
| PubChem CID | 50936105 |
| Molecular Formula | C14H16Cl2GaN8S2 |
| Molecular Weight | 501.10 g/mol |
| Exact Mass | 498.96 |
| IUPAC Name | — |
| SMILES | Cl[Ga]Cl.NC(=S)NN=Cc1ccccn1.NC(=S)NN=Cc1ccccn1 |
| InChI | InChI=1S/2C7H8N4S.2ClH.Ga/c2*8-7(12)11-10-5-6-3-1-2-4-9-6;;;/h2*1-5H,(H3,8,11,12);2*1H;/q;;;;+2/p-2 |
| InChIKey | TYICUZATDWOWJW-UHFFFAOYSA-L |
| XLogP | 1.50 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 50936105 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 50936105?
The IUPAC name of CID 50936105 (CID 50936105) is not available.
What is the SMILES notation for CID 50936105?
The canonical SMILES for CID 50936105 is Cl[Ga]Cl.NC(=S)NN=Cc1ccccn1.NC(=S)NN=Cc1ccccn1.
What is the InChIKey of CID 50936105?
The InChIKey is TYICUZATDWOWJW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8N4S.2ClH.Ga/c2*8-7(12)11-10-5-6-3-1-2-4-9-6;;;/h2*1-5H,(H3,8,11,12);2*1H;/q;;;;+2/p-2.
What are the key properties of CID 50936105?
CID 50936105 has a molecular weight of 501.10 g/mol, XLogP of 1.50, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 50936105 is sourced from PubChem (CID 50936105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).