About 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate
2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate (PubChem CID 139147248) has the molecular formula C13H14ClN3O3
and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate.
Molecular Properties
| Compound Name | 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate |
| PubChem CID | 139147248 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate |
| SMILES | O.O.O=C(N/N=C/c1ccccn1)c1ccccc1Cl |
| InChI | InChI=1S/C13H10ClN3O.2H2O/c14-12-7-2-1-6-11(12)13(18)17-16-9-10-5-3-4-8-15-10;;/h1-9H,(H,17,18);2*1H2/b16-9+;; |
| InChIKey | AOPBBWXQZSQNIT-NENXIMLWSA-N |
| XLogP | 0.85 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate?
The IUPAC name of 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate (CID 139147248) is 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate.
What is the SMILES notation for 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate?
The canonical SMILES for 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate is O.O.O=C(N/N=C/c1ccccn1)c1ccccc1Cl.
What is the InChIKey of 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate?
The InChIKey is AOPBBWXQZSQNIT-NENXIMLWSA-N. The full InChI is InChI=1S/C13H10ClN3O.2H2O/c14-12-7-2-1-6-11(12)13(18)17-16-9-10-5-3-4-8-15-10;;/h1-9H,(H,17,18);2*1H2/b16-9+;;.
What are the key properties of 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate?
2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate has a molecular weight of 295.73 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(E)-pyridin-2-ylmethylideneamino]benzamide;dihydrate is sourced from PubChem (CID 139147248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).