C19H15N7O2 — CID 5437141
2-N,6-N-bis[(Z)-pyridin-2-ylmethylideneamino]pyridine-2,6-dicarboxamide (PubChem CID 5437141) has the molecular formula C19H15N7O2 and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-N,6-N-bis[(Z)-pyridin-2-ylmethylideneamino]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[(Z)-pyridin-2-ylmethylideneamino]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 5437141 |
| Molecular Formula | C19H15N7O2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-N,6-N-bis[(Z)-pyridin-2-ylmethylideneamino]pyridine-2,6-dicarboxamide |
| SMILES | O=C(N/N=C\c1ccccn1)c1cccc(C(=O)N/N=C\c2ccccn2)n1 |
| InChI | InChI=1S/C19H15N7O2/c27-18(25-22-12-14-6-1-3-10-20-14)16-8-5-9-17(24-16)19(28)26-23-13-15-7-2-4-11-21-15/h1-13H,(H,25,27)(H,26,28)/b22-12-,23-13- |
| InChIKey | PSRZBKALAQVREC-YFBGDSSHSA-N |
| XLogP | 1.40 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|