C13H12Cd2N6S+4 — CID 10436322
1,3-bis[(E)-pyridin-2-ylmethylideneamino]thiourea;bis(cadmium(2+)) (PubChem CID 10436322) has the molecular formula C13H12Cd2N6S+4 and a molecular weight of 509.17 g/mol. Its IUPAC name is 1,3-bis[(E)-pyridin-2-ylmethylideneamino]thiourea;bis(cadmium(2+)).
| Compound Name | 1,3-bis[(E)-pyridin-2-ylmethylideneamino]thiourea;bis(cadmium(2+)) |
|---|---|
| PubChem CID | 10436322 |
| Molecular Formula | C13H12Cd2N6S+4 |
| Molecular Weight | 509.17 g/mol |
| Exact Mass | 511.89 |
| IUPAC Name | 1,3-bis[(E)-pyridin-2-ylmethylideneamino]thiourea;bis(cadmium(2+)) |
| SMILES | S=C(N/N=C/c1ccccn1)N/N=C/c1ccccn1.[Cd+2].[Cd+2] |
| InChI | InChI=1S/C13H12N6S.2Cd/c20-13(18-16-9-11-5-1-3-7-14-11)19-17-10-12-6-2-4-8-15-12;;/h1-10H,(H2,18,19,20);;/q;2*+2/b16-9+,17-10+;; |
| InChIKey | KRDPHGWZPQFXQH-APEFMPSWSA-N |
| XLogP | 1.30 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|