C14H14Cl2CuN4OS — CID 3005720
dichlorocopper;1-(2-methoxyphenyl)-3-(pyridin-2-ylmethylideneamino)thiourea (PubChem CID 3005720) has the molecular formula C14H14Cl2CuN4OS and a molecular weight of 420.81 g/mol. Its IUPAC name is dichlorocopper;1-(2-methoxyphenyl)-3-(pyridin-2-ylmethylideneamino)thiourea.
| Compound Name | dichlorocopper;1-(2-methoxyphenyl)-3-(pyridin-2-ylmethylideneamino)thiourea |
|---|---|
| PubChem CID | 3005720 |
| Molecular Formula | C14H14Cl2CuN4OS |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | dichlorocopper;1-(2-methoxyphenyl)-3-(pyridin-2-ylmethylideneamino)thiourea |
| SMILES | COc1ccccc1NC(=S)NN=Cc1ccccn1.Cl[Cu]Cl |
| InChI | InChI=1S/C14H14N4OS.2ClH.Cu/c1-19-13-8-3-2-7-12(13)17-14(20)18-16-10-11-6-4-5-9-15-11;;;/h2-10H,1H3,(H2,17,18,20);2*1H;/q;;;+2/p-2 |
| InChIKey | MPMDWEIQPNNAIB-UHFFFAOYSA-L |
| XLogP | 3.79 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|