C11H16Cl2CuN4S — CID 3005763
1-butyl-3-(pyridin-2-ylmethylideneamino)thiourea;dichlorocopper (PubChem CID 3005763) has the molecular formula C11H16Cl2CuN4S and a molecular weight of 370.80 g/mol. Its IUPAC name is 1-butyl-3-(pyridin-2-ylmethylideneamino)thiourea;dichlorocopper.
| Compound Name | 1-butyl-3-(pyridin-2-ylmethylideneamino)thiourea;dichlorocopper |
|---|---|
| PubChem CID | 3005763 |
| Molecular Formula | C11H16Cl2CuN4S |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 1-butyl-3-(pyridin-2-ylmethylideneamino)thiourea;dichlorocopper |
| SMILES | CCCCNC(=S)NN=Cc1ccccn1.Cl[Cu]Cl |
| InChI | InChI=1S/C11H16N4S.2ClH.Cu/c1-2-3-7-13-11(16)15-14-9-10-6-4-5-8-12-10;;;/h4-6,8-9H,2-3,7H2,1H3,(H2,13,15,16);2*1H;/q;;;+2/p-2 |
| InChIKey | HVGIYBRRHHSAOV-UHFFFAOYSA-L |
| XLogP | 3.06 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|