C12H18N4S — CID 3005785
1-butyl-3-[(6-methyl-2-pyridinyl)methylideneamino]thiourea (PubChem CID 3005785) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-butyl-3-[(6-methyl-2-pyridinyl)methylideneamino]thiourea.
| Compound Name | 1-butyl-3-[(6-methyl-2-pyridinyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3005785 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1-butyl-3-[(6-methyl-2-pyridinyl)methylideneamino]thiourea |
| SMILES | CCCCNC(=S)NN=Cc1cccc(C)n1 |
| InChI | InChI=1S/C12H18N4S/c1-3-4-8-13-12(17)16-14-9-11-7-5-6-10(2)15-11/h5-7,9H,3-4,8H2,1-2H3,(H2,13,16,17) |
| InChIKey | ZIBHAWZAOBJNEG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|