About copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate
copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate (PubChem CID 175779142) has the molecular formula C9H11CuN3S2
and a molecular weight of 288.89 g/mol. Its IUPAC name is copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate.
Molecular Properties
| Compound Name | copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate |
| PubChem CID | 175779142 |
| Molecular Formula | C9H11CuN3S2 |
| Molecular Weight | 288.89 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate |
| SMILES | CSC(=S)NN=Cc1cccc(C)n1.[Cu] |
| InChI | InChI=1S/C9H11N3S2.Cu/c1-7-4-3-5-8(11-7)6-10-12-9(13)14-2;/h3-6H,1-2H3,(H,12,13); |
| InChIKey | FMWKYISQAUNVCT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.89 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate?
The IUPAC name of copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate (CID 175779142) is copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate.
What is the SMILES notation for copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate?
The canonical SMILES for copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate is CSC(=S)NN=Cc1cccc(C)n1.[Cu].
What is the InChIKey of copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate?
The InChIKey is FMWKYISQAUNVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S2.Cu/c1-7-4-3-5-8(11-7)6-10-12-9(13)14-2;/h3-6H,1-2H3,(H,12,13);.
What are the key properties of copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate?
copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate has a molecular weight of 288.89 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate is sourced from PubChem (CID 175779142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).