C13H18CuN4S+2 — CID 50910602
copper N-[(6-methyl-2-pyridinyl)methylideneamino]piperidine-1-carbothioamide (PubChem CID 50910602) has the molecular formula C13H18CuN4S+2 and a molecular weight of 325.93 g/mol. Its IUPAC name is copper N-[(6-methyl-2-pyridinyl)methylideneamino]piperidine-1-carbothioamide.
| Compound Name | copper N-[(6-methyl-2-pyridinyl)methylideneamino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 50910602 |
| Molecular Formula | C13H18CuN4S+2 |
| Molecular Weight | 325.93 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | copper N-[(6-methyl-2-pyridinyl)methylideneamino]piperidine-1-carbothioamide |
| SMILES | Cc1cccc(C=NNC(=S)N2CCCCC2)n1.[Cu+2] |
| InChI | InChI=1S/C13H18N4S.Cu/c1-11-6-5-7-12(15-11)10-14-16-13(18)17-8-3-2-4-9-17;/h5-7,10H,2-4,8-9H2,1H3,(H,16,18);/q;+2 |
| InChIKey | GKPPBZCHBXHELO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.93 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|