C28H36N6O2PdS2 — CID 11679105
bis(2-[(E)-(azepane-1-carbothioylhydrazinylidene)methyl]phenolate);palladium(2+) (PubChem CID 11679105) has the molecular formula C28H36N6O2PdS2 and a molecular weight of 659.19 g/mol. Its IUPAC name is bis(2-[(E)-(azepane-1-carbothioylhydrazinylidene)methyl]phenolate);palladium(2+).
| Compound Name | bis(2-[(E)-(azepane-1-carbothioylhydrazinylidene)methyl]phenolate);palladium(2+) |
|---|---|
| PubChem CID | 11679105 |
| Molecular Formula | C28H36N6O2PdS2 |
| Molecular Weight | 659.19 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | bis(2-[(E)-(azepane-1-carbothioylhydrazinylidene)methyl]phenolate);palladium(2+) |
| SMILES | [O-]c1ccccc1/C=N/NC(=S)N1CCCCCC1.[O-]c1ccccc1/C=N/NC(=S)N1CCCCCC1.[Pd+2] |
| InChI | InChI=1S/2C14H19N3OS.Pd/c2*18-13-8-4-3-7-12(13)11-15-16-14(19)17-9-5-1-2-6-10-17;/h2*3-4,7-8,11,18H,1-2,5-6,9-10H2,(H,16,19);/q;;+2/p-2/b2*15-11+; |
| InChIKey | HRESGPJOMDAJSK-UXZGHTKGSA-L |
| XLogP | 3.69 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|