C13H17N4O3S- — CID 135801262
4-(dihydroxyamino)-2-[(Z)-(piperidine-1-carbothioylhydrazinylidene)methyl]phenolate (PubChem CID 135801262) has the molecular formula C13H17N4O3S- and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-(dihydroxyamino)-2-[(Z)-(piperidine-1-carbothioylhydrazinylidene)methyl]phenolate.
| Compound Name | 4-(dihydroxyamino)-2-[(Z)-(piperidine-1-carbothioylhydrazinylidene)methyl]phenolate |
|---|---|
| PubChem CID | 135801262 |
| Molecular Formula | C13H17N4O3S- |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-(dihydroxyamino)-2-[(Z)-(piperidine-1-carbothioylhydrazinylidene)methyl]phenolate |
| SMILES | [O-]c1ccc(N(O)O)cc1/C=N\NC(=S)N1CCCCC1 |
| InChI | InChI=1S/C13H18N4O3S/c18-12-5-4-11(17(19)20)8-10(12)9-14-15-13(21)16-6-2-1-3-7-16/h4-5,8-9,18-20H,1-3,6-7H2,(H,15,21)/p-1/b14-9- |
| InChIKey | VBLDFWCGSUZUMJ-ZROIWOOFSA-M |
| XLogP | 1.04 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|