C15H26N6S2 — CID 6477573
N-[(Z)-[(2E)-2-(piperidine-1-carbothioylhydrazinylidene)propylidene]amino]piperidine-1-carbothioamide (PubChem CID 6477573) has the molecular formula C15H26N6S2 and a molecular weight of 354.55 g/mol. Its IUPAC name is N-[(Z)-[(2E)-2-(piperidine-1-carbothioylhydrazinylidene)propylidene]amino]piperidine-1-carbothioamide.
| Compound Name | N-[(Z)-[(2E)-2-(piperidine-1-carbothioylhydrazinylidene)propylidene]amino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 6477573 |
| Molecular Formula | C15H26N6S2 |
| Molecular Weight | 354.55 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[(Z)-[(2E)-2-(piperidine-1-carbothioylhydrazinylidene)propylidene]amino]piperidine-1-carbothioamide |
| SMILES | CC(/C=N\NC(=S)N1CCCCC1)=N\NC(=S)N1CCCCC1 |
| InChI | InChI=1S/C15H26N6S2/c1-13(17-19-15(23)21-10-6-3-7-11-21)12-16-18-14(22)20-8-4-2-5-9-20/h12H,2-11H2,1H3,(H,18,22)(H,19,23)/b16-12-,17-13+ |
| InChIKey | UNSNRXLRFNYEKO-RFTYBOQRSA-N |
| XLogP | 2.07 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|