C11H15N5S — CID 5371251
N-[(E)-1-pyrimidin-2-ylethylideneamino]pyrrolidine-1-carbothioamide (PubChem CID 5371251) has the molecular formula C11H15N5S and a molecular weight of 249.34 g/mol. Its IUPAC name is N-[(E)-1-pyrimidin-2-ylethylideneamino]pyrrolidine-1-carbothioamide.
| Compound Name | N-[(E)-1-pyrimidin-2-ylethylideneamino]pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 5371251 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[(E)-1-pyrimidin-2-ylethylideneamino]pyrrolidine-1-carbothioamide |
| SMILES | C/C(=N\NC(=S)N1CCCC1)c1ncccn1 |
| InChI | InChI=1S/C11H15N5S/c1-9(10-12-5-4-6-13-10)14-15-11(17)16-7-2-3-8-16/h4-6H,2-3,7-8H2,1H3,(H,15,17)/b14-9+ |
| InChIKey | NTZMYPLPIHFZSE-NTEUORMPSA-N |
| XLogP | 1.17 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|