C16H18N6S — CID 25112862
4-pyridin-2-yl-N-[(E)-pyridin-2-ylmethylideneamino]piperazine-1-carbothioamide (PubChem CID 25112862) has the molecular formula C16H18N6S and a molecular weight of 326.43 g/mol. Its IUPAC name is 4-pyridin-2-yl-N-[(E)-pyridin-2-ylmethylideneamino]piperazine-1-carbothioamide.
| Compound Name | 4-pyridin-2-yl-N-[(E)-pyridin-2-ylmethylideneamino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 25112862 |
| Molecular Formula | C16H18N6S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-pyridin-2-yl-N-[(E)-pyridin-2-ylmethylideneamino]piperazine-1-carbothioamide |
| SMILES | S=C(N/N=C/c1ccccn1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C16H18N6S/c23-16(20-19-13-14-5-1-3-7-17-14)22-11-9-21(10-12-22)15-6-2-4-8-18-15/h1-8,13H,9-12H2,(H,20,23)/b19-13+ |
| InChIKey | QLGABAIYSXWVFZ-CPNJWEJPSA-N |
| XLogP | 1.51 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|