C20H26N6S — CID 89140367
N-[(Z)-[2-amino-3-[(1Z)-buta-1,3-dienyl]cyclohex-2-en-1-ylidene]amino]-4-pyridin-2-ylpiperazine-1-carbothioamide (PubChem CID 89140367) has the molecular formula C20H26N6S and a molecular weight of 382.54 g/mol. Its IUPAC name is N-[(Z)-[2-amino-3-[(1Z)-buta-1,3-dienyl]cyclohex-2-en-1-ylidene]amino]-4-pyridin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-[2-amino-3-[(1Z)-buta-1,3-dienyl]cyclohex-2-en-1-ylidene]amino]-4-pyridin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 89140367 |
| Molecular Formula | C20H26N6S |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-[(Z)-[2-amino-3-[(1Z)-buta-1,3-dienyl]cyclohex-2-en-1-ylidene]amino]-4-pyridin-2-ylpiperazine-1-carbothioamide |
| SMILES | C=C/C=C\C1=C(N)/C(=N\NC(=S)N2CCN(c3ccccn3)CC2)CCC1 |
| InChI | InChI=1S/C20H26N6S/c1-2-3-7-16-8-6-9-17(19(16)21)23-24-20(27)26-14-12-25(13-15-26)18-10-4-5-11-22-18/h2-5,7,10-11H,1,6,8-9,12-15,21H2,(H,24,27)/b7-3-,23-17- |
| InChIKey | STMLEVFAJDELMX-FTERVMMXSA-N |
| XLogP | 2.57 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|