C12H17N3O — CID 122598259
1-(4-pyridin-2-yl-1,4-diazepan-1-yl)ethanone (PubChem CID 122598259) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-(4-pyridin-2-yl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 1-(4-pyridin-2-yl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 122598259 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-(4-pyridin-2-yl-1,4-diazepan-1-yl)ethanone |
| SMILES | CC(=O)N1CCCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C12H17N3O/c1-11(16)14-7-4-8-15(10-9-14)12-5-2-3-6-13-12/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | HEKDSDSSKGSOEL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |