C22H22N4O — CID 167843840
(5-phenyl-2-pyridinyl)-(4-pyridin-2-yl-1,4-diazepan-1-yl)methanone (PubChem CID 167843840) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is (5-phenyl-2-pyridinyl)-(4-pyridin-2-yl-1,4-diazepan-1-yl)methanone.
| Compound Name | (5-phenyl-2-pyridinyl)-(4-pyridin-2-yl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 167843840 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (5-phenyl-2-pyridinyl)-(4-pyridin-2-yl-1,4-diazepan-1-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cn1)N1CCCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H22N4O/c27-22(20-11-10-19(17-24-20)18-7-2-1-3-8-18)26-14-6-13-25(15-16-26)21-9-4-5-12-23-21/h1-5,7-12,17H,6,13-16H2 |
| InChIKey | DKQCXQGQRGXCMW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |