C12H16FN3O — CID 55002941
1-[4-(6-fluoro-2-pyridinyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 55002941) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-[4-(6-fluoro-2-pyridinyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(6-fluoro-2-pyridinyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 55002941 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-[4-(6-fluoro-2-pyridinyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2cccc(F)n2)CC1 |
| InChI | InChI=1S/C12H16FN3O/c1-10(17)15-6-3-7-16(9-8-15)12-5-2-4-11(13)14-12/h2,4-5H,3,6-9H2,1H3 |
| InChIKey | VJSXIFNTILDCIL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|