C10H13FN2OS — CID 130644916
4-(6-fluoro-2-pyridinyl)-1,4-thiazepane 1-oxide (PubChem CID 130644916) has the molecular formula C10H13FN2OS and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-(6-fluoro-2-pyridinyl)-1,4-thiazepane 1-oxide.
| Compound Name | 4-(6-fluoro-2-pyridinyl)-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 130644916 |
| Molecular Formula | C10H13FN2OS |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 4-(6-fluoro-2-pyridinyl)-1,4-thiazepane 1-oxide |
| SMILES | O=S1CCCN(c2cccc(F)n2)CC1 |
| InChI | InChI=1S/C10H13FN2OS/c11-9-3-1-4-10(12-9)13-5-2-7-15(14)8-6-13/h1,3-4H,2,5-8H2 |
| InChIKey | LDCGCEYZFGBWDT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|