C17H20FN3 — CID 130624204
1-benzyl-4-(6-fluoro-2-pyridinyl)-1,4-diazepane (PubChem CID 130624204) has the molecular formula C17H20FN3 and a molecular weight of 285.37 g/mol. Its IUPAC name is 1-benzyl-4-(6-fluoro-2-pyridinyl)-1,4-diazepane.
| Compound Name | 1-benzyl-4-(6-fluoro-2-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 130624204 |
| Molecular Formula | C17H20FN3 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-benzyl-4-(6-fluoro-2-pyridinyl)-1,4-diazepane |
| SMILES | Fc1cccc(N2CCCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H20FN3/c18-16-8-4-9-17(19-16)21-11-5-10-20(12-13-21)14-15-6-2-1-3-7-15/h1-4,6-9H,5,10-14H2 |
| InChIKey | YILILBALDKJIET-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|