C13H21FN4 — CID 55128004
2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]-N,N-dimethylethanamine (PubChem CID 55128004) has the molecular formula C13H21FN4 and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 55128004 |
| Molecular Formula | C13H21FN4 |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCN1CCN(c2cccc(F)n2)CC1 |
| InChI | InChI=1S/C13H21FN4/c1-16(2)6-7-17-8-10-18(11-9-17)13-5-3-4-12(14)15-13/h3-5H,6-11H2,1-2H3 |
| InChIKey | BMSINQPLZDWQIF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|