C13H17FN6O — CID 110187474
3-[[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]methyl]-2,5-dihydro-1H-1,2,4-triazin-6-one (PubChem CID 110187474) has the molecular formula C13H17FN6O and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-[[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]methyl]-2,5-dihydro-1H-1,2,4-triazin-6-one.
| Compound Name | 3-[[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]methyl]-2,5-dihydro-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 110187474 |
| Molecular Formula | C13H17FN6O |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-[[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]methyl]-2,5-dihydro-1H-1,2,4-triazin-6-one |
| SMILES | O=C1CN=C(CN2CCN(c3cccc(F)n3)CC2)NN1 |
| InChI | InChI=1S/C13H17FN6O/c14-10-2-1-3-12(16-10)20-6-4-19(5-7-20)9-11-15-8-13(21)18-17-11/h1-3H,4-9H2,(H,15,17)(H,18,21) |
| InChIKey | BELIRMYGLORMDL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|