C21H27FN4O — CID 11501572
N-[2-[4-[[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]methyl]phenyl]propan-2-yl]acetamide (PubChem CID 11501572) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[2-[4-[[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]methyl]phenyl]propan-2-yl]acetamide.
| Compound Name | N-[2-[4-[[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]methyl]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 11501572 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N-[2-[4-[[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]methyl]phenyl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)c1ccc(CN2CCN(c3cccc(F)n3)CC2)cc1 |
| InChI | InChI=1S/C21H27FN4O/c1-16(27)24-21(2,3)18-9-7-17(8-10-18)15-25-11-13-26(14-12-25)20-6-4-5-19(22)23-20/h4-10H,11-15H2,1-3H3,(H,24,27) |
| InChIKey | PXMGICCWARXCEM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|