C16H22FN5O2 — CID 133337586
5-[[4-(6-fluoro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-3-(1-methoxyethyl)-1,2,4-oxadiazole (PubChem CID 133337586) has the molecular formula C16H22FN5O2 and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-[[4-(6-fluoro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-3-(1-methoxyethyl)-1,2,4-oxadiazole.
| Compound Name | 5-[[4-(6-fluoro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-3-(1-methoxyethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133337586 |
| Molecular Formula | C16H22FN5O2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 5-[[4-(6-fluoro-2-pyridinyl)-1,4-diazepan-1-yl]methyl]-3-(1-methoxyethyl)-1,2,4-oxadiazole |
| SMILES | COC(C)c1noc(CN2CCCN(c3cccc(F)n3)CC2)n1 |
| InChI | InChI=1S/C16H22FN5O2/c1-12(23-2)16-19-15(24-20-16)11-21-7-4-8-22(10-9-21)14-6-3-5-13(17)18-14/h3,5-6,12H,4,7-11H2,1-2H3 |
| InChIKey | LSJCPGPZGAXZFN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|